C18H21N3O3 — CID 14053735
5-[4-[(E)-3-phenylprop-2-enoyl]piperazine-1-carbonyl]pyrrolidin-2-one (PubChem CID 14053735) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 5-[4-[(E)-3-phenylprop-2-enoyl]piperazine-1-carbonyl]pyrrolidin-2-one.
| Compound Name | 5-[4-[(E)-3-phenylprop-2-enoyl]piperazine-1-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 14053735 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 5-[4-[(E)-3-phenylprop-2-enoyl]piperazine-1-carbonyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(C(=O)N2CCN(C(=O)/C=C/c3ccccc3)CC2)N1 |
| InChI | InChI=1S/C18H21N3O3/c22-16-8-7-15(19-16)18(24)21-12-10-20(11-13-21)17(23)9-6-14-4-2-1-3-5-14/h1-6,9,15H,7-8,10-13H2,(H,19,22)/b9-6+ |
| InChIKey | RFSLTYPWDLQZBC-RMKNXTFCSA-N |
| XLogP | 0.65 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|