C5H10N2O3 — CID 140539676
1,2-dihydroxypyrrolidine-2-carboxamide (PubChem CID 140539676) has the molecular formula C5H10N2O3 and a molecular weight of 146.15 g/mol. Its IUPAC name is 1,2-dihydroxypyrrolidine-2-carboxamide.
| Compound Name | 1,2-dihydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 140539676 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 1,2-dihydroxypyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1(O)CCCN1O |
| InChI | InChI=1S/C5H10N2O3/c6-4(8)5(9)2-1-3-7(5)10/h9-10H,1-3H2,(H2,6,8) |
| InChIKey | KOFSMGHDBUIABR-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |