1,2-dihydroxypiperidine-2-carboxylic acid

C6H11NO4 — CID 68700231

IUPAC1,2-dihydroxypiperidine-2-carboxylic acid
SMILESO=C(O)C1(O)CCCCN1O
InChIInChI=1S/C6H11NO4/c8-5(9)6(10)3-1-2-4-7(6)11/h10-11H,1-4H2,(H,8,9)
InChIKeyYXSVZAJSHPUFKH-UHFFFAOYSA-N
MW161.16 g/mol
LogP-0.37
Rot. Bonds1

About 1,2-dihydroxypiperidine-2-carboxylic acid

1,2-dihydroxypiperidine-2-carboxylic acid (PubChem CID 68700231) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is 1,2-dihydroxypiperidine-2-carboxylic acid.

Molecular Properties

Compound Name1,2-dihydroxypiperidine-2-carboxylic acid
PubChem CID68700231
Molecular FormulaC6H11NO4
Molecular Weight161.16 g/mol
Exact Mass161.07
IUPAC Name1,2-dihydroxypiperidine-2-carboxylic acid
SMILESO=C(O)C1(O)CCCCN1O
InChIInChI=1S/C6H11NO4/c8-5(9)6(10)3-1-2-4-7(6)11/h10-11H,1-4H2,(H,8,9)
InChIKeyYXSVZAJSHPUFKH-UHFFFAOYSA-N
XLogP-0.37
TPSA81.00 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.16
LogP ≤ 5-0.37
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 1,2-dihydroxypiperidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

1,2-dihydroxypyrrolidine-2-carboxamide
CID 140539676
tert-butyl (2R)-1,2-dihydroxypyrrolidine-2-carboxylate
CID 139658733
2-(2-aminoacetyl)-1-hydroxypyrrolidine-2-carboxylic acid
CID 19609664
(2R,3R)-1,2,3-trihydroxypiperidine-2-carboxylic acid
CID 66850737
(2R)-1-carbamimidoyl-2-hydroxypyrrolidine-2-carboxylic acid
CID 139754634
1-decyl-2-hydroxypyrrolidine-2-carboxylic acid
CID 66691415
2-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid
CID 22556536
1,2-dimethylpiperidine-2-carboxylic acid
CID 73440704
2-fluoropyrrolidine-1,2-dicarboxylic acid
CID 69306748
1-piperidin-1-ylsulfonylcyclopentane-1-carboxylic acid
CID 115048845
cyclooctane-1,1-dicarboxylic acid
CID 18521139
cyclohexane-1,1-dicarboxylic acid
CID 70539849

Frequently Asked Questions

What is the IUPAC name of 1,2-dihydroxypiperidine-2-carboxylic acid?
The IUPAC name of 1,2-dihydroxypiperidine-2-carboxylic acid (CID 68700231) is 1,2-dihydroxypiperidine-2-carboxylic acid.
What is the SMILES notation for 1,2-dihydroxypiperidine-2-carboxylic acid?
The canonical SMILES for 1,2-dihydroxypiperidine-2-carboxylic acid is O=C(O)C1(O)CCCCN1O.
What is the InChIKey of 1,2-dihydroxypiperidine-2-carboxylic acid?
The InChIKey is YXSVZAJSHPUFKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO4/c8-5(9)6(10)3-1-2-4-7(6)11/h10-11H,1-4H2,(H,8,9).
What are the key properties of 1,2-dihydroxypiperidine-2-carboxylic acid?
1,2-dihydroxypiperidine-2-carboxylic acid has a molecular weight of 161.16 g/mol, XLogP of -0.37, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroxypiperidine-2-carboxylic acid is sourced from PubChem (CID 68700231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).