About CID 140540298
CID 140540298 (PubChem CID 140540298) has the molecular formula C43H48Zr
and a molecular weight of 656.08 g/mol.
Molecular Properties
| Compound Name | CID 140540298 |
| PubChem CID | 140540298 |
| Molecular Formula | C43H48Zr |
| Molecular Weight | 656.08 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | — |
| SMILES | CC1=[C-]C(C)(C)c2cc3c(cc21)-c1cc2c(cc1C3)C(C)(C)C=C2C.CCC1[C-]=CC(C(C)(C)C)=C1.[Zr+2]=Cc1ccccc1 |
| InChI | InChI=1S/C25H25.C11H17.C7H6.Zr/c1-14-12-24(3,4)22-8-16-7-17-9-23-19(15(2)13-25(23,5)6)11-21(17)20(16)10-18(14)22;1-5-9-6-7-10(8-9)11(2,3)4;1-7-5-3-2-4-6-7;/h8-12H,7H2,1-6H3;7-9H,5H2,1-4H3;1-6H;/q2*-1;;+2 |
| InChIKey | SYXYZZLRIPFVPA-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 656.08 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 140540298 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140540298?
The IUPAC name of CID 140540298 (CID 140540298) is not available.
What is the SMILES notation for CID 140540298?
The canonical SMILES for CID 140540298 is CC1=[C-]C(C)(C)c2cc3c(cc21)-c1cc2c(cc1C3)C(C)(C)C=C2C.CCC1[C-]=CC(C(C)(C)C)=C1.[Zr+2]=Cc1ccccc1.
What is the InChIKey of CID 140540298?
The InChIKey is SYXYZZLRIPFVPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25.C11H17.C7H6.Zr/c1-14-12-24(3,4)22-8-16-7-17-9-23-19(15(2)13-25(23,5)6)11-21(17)20(16)10-18(14)22;1-5-9-6-7-10(8-9)11(2,3)4;1-7-5-3-2-4-6-7;/h8-12H,7H2,1-6H3;7-9H,5H2,1-4H3;1-6H;/q2*-1;;+2.
What are the key properties of CID 140540298?
CID 140540298 has a molecular weight of 656.08 g/mol, XLogP of 11.19, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140540298 is sourced from PubChem (CID 140540298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).