C45H52Zr — CID 173138235
CID 173138235 (PubChem CID 173138235) has the molecular formula C45H52Zr and a molecular weight of 684.14 g/mol.
| Compound Name | CID 173138235 |
|---|---|
| PubChem CID | 173138235 |
| Molecular Formula | C45H52Zr |
| Molecular Weight | 684.14 g/mol |
| Exact Mass | 682.31 |
| IUPAC Name | — |
| SMILES | CC1=CC(C)(C)c2cc3[cH-]c4cc5c(cc4c3cc21)C(C)=CC5(C)C.CCC1=[C-]C(CC)C=C1C(C)(C)C.[Zr+2]=Cc1ccccc1 |
| InChI | InChI=1S/C25H25.C13H21.C7H6.Zr/c1-14-12-24(3,4)22-8-16-7-17-9-23-19(15(2)13-25(23,5)6)11-21(17)20(16)10-18(14)22;1-6-10-8-11(7-2)12(9-10)13(3,4)5;1-7-5-3-2-4-6-7;/h7-13H,1-6H3;9-10H,6-7H2,1-5H3;1-6H;/q2*-1;;+2 |
| InChIKey | HVYKDZWHVTWEOX-UHFFFAOYSA-N |
| XLogP | 12.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.14 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|