About CID 173138235
CID 173138235 (PubChem CID 173138235) has the molecular formula C45H52Zr
and a molecular weight of 684.14 g/mol.
Molecular Properties
| Compound Name | CID 173138235 |
| PubChem CID | 173138235 |
| Molecular Formula | C45H52Zr |
| Molecular Weight | 684.14 g/mol |
| Exact Mass | 682.31 |
| IUPAC Name | — |
| SMILES | CC1=CC(C)(C)c2cc3[cH-]c4cc5c(cc4c3cc21)C(C)=CC5(C)C.CCC1=[C-]C(CC)C=C1C(C)(C)C.[Zr+2]=Cc1ccccc1 |
| InChI | InChI=1S/C25H25.C13H21.C7H6.Zr/c1-14-12-24(3,4)22-8-16-7-17-9-23-19(15(2)13-25(23,5)6)11-21(17)20(16)10-18(14)22;1-6-10-8-11(7-2)12(9-10)13(3,4)5;1-7-5-3-2-4-6-7;/h7-13H,1-6H3;9-10H,6-7H2,1-5H3;1-6H;/q2*-1;;+2 |
| InChIKey | HVYKDZWHVTWEOX-UHFFFAOYSA-N |
| XLogP | 12.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 684.14 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 173138235 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173138235?
The IUPAC name of CID 173138235 (CID 173138235) is not available.
What is the SMILES notation for CID 173138235?
The canonical SMILES for CID 173138235 is CC1=CC(C)(C)c2cc3[cH-]c4cc5c(cc4c3cc21)C(C)=CC5(C)C.CCC1=[C-]C(CC)C=C1C(C)(C)C.[Zr+2]=Cc1ccccc1.
What is the InChIKey of CID 173138235?
The InChIKey is HVYKDZWHVTWEOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25.C13H21.C7H6.Zr/c1-14-12-24(3,4)22-8-16-7-17-9-23-19(15(2)13-25(23,5)6)11-21(17)20(16)10-18(14)22;1-6-10-8-11(7-2)12(9-10)13(3,4)5;1-7-5-3-2-4-6-7;/h7-13H,1-6H3;9-10H,6-7H2,1-5H3;1-6H;/q2*-1;;+2.
What are the key properties of CID 173138235?
CID 173138235 has a molecular weight of 684.14 g/mol, XLogP of 12.62, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173138235 is sourced from PubChem (CID 173138235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).