C40H56Zr — CID 173138303
2-tert-butyl-3,5-diethylcyclopenta-1,3-diene;cyclohexylidenezirconium(2+);3,6-ditert-butyl-9H-fluoren-9-ide (PubChem CID 173138303) has the molecular formula C40H56Zr and a molecular weight of 628.11 g/mol. Its IUPAC name is 2-tert-butyl-3,5-diethylcyclopenta-1,3-diene;cyclohexylidenezirconium(2+);3,6-ditert-butyl-9H-fluoren-9-ide.
| Compound Name | 2-tert-butyl-3,5-diethylcyclopenta-1,3-diene;cyclohexylidenezirconium(2+);3,6-ditert-butyl-9H-fluoren-9-ide |
|---|---|
| PubChem CID | 173138303 |
| Molecular Formula | C40H56Zr |
| Molecular Weight | 628.11 g/mol |
| Exact Mass | 626.34 |
| IUPAC Name | 2-tert-butyl-3,5-diethylcyclopenta-1,3-diene;cyclohexylidenezirconium(2+);3,6-ditert-butyl-9H-fluoren-9-ide |
| SMILES | CC(C)(C)c1ccc2[cH-]c3ccc(C(C)(C)C)cc3c2c1.CCC1=[C-]C(CC)C=C1C(C)(C)C.[Zr+2]=C1CCCCC1 |
| InChI | InChI=1S/C21H25.C13H21.C6H10.Zr/c1-20(2,3)16-9-7-14-11-15-8-10-17(21(4,5)6)13-19(15)18(14)12-16;1-6-10-8-11(7-2)12(9-10)13(3,4)5;1-2-4-6-5-3-1;/h7-13H,1-6H3;9-10H,6-7H2,1-5H3;1-5H2;/q2*-1;;+2 |
| InChIKey | JMLHLFDKHDEZNU-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.11 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|