C43H56Zr — CID 173107068
cyclohexylidenezirconium(2+);3,6-ditert-butyl-9H-fluoren-9-ide;1-(3-methylcyclopenta-1,4-dien-1-yl)adamantane (PubChem CID 173107068) has the molecular formula C43H56Zr and a molecular weight of 664.15 g/mol. Its IUPAC name is cyclohexylidenezirconium(2+);3,6-ditert-butyl-9H-fluoren-9-ide;1-(3-methylcyclopenta-1,4-dien-1-yl)adamantane.
| Compound Name | cyclohexylidenezirconium(2+);3,6-ditert-butyl-9H-fluoren-9-ide;1-(3-methylcyclopenta-1,4-dien-1-yl)adamantane |
|---|---|
| PubChem CID | 173107068 |
| Molecular Formula | C43H56Zr |
| Molecular Weight | 664.15 g/mol |
| Exact Mass | 662.34 |
| IUPAC Name | cyclohexylidenezirconium(2+);3,6-ditert-butyl-9H-fluoren-9-ide;1-(3-methylcyclopenta-1,4-dien-1-yl)adamantane |
| SMILES | CC(C)(C)c1ccc2[cH-]c3ccc(C(C)(C)C)cc3c2c1.CC1[C-]=C(C23CC4CC(CC(C4)C2)C3)C=C1.[Zr+2]=C1CCCCC1 |
| InChI | InChI=1S/C21H25.C16H21.C6H10.Zr/c1-20(2,3)16-9-7-14-11-15-8-10-17(21(4,5)6)13-19(15)18(14)12-16;1-11-2-3-15(4-11)16-8-12-5-13(9-16)7-14(6-12)10-16;1-2-4-6-5-3-1;/h7-13H,1-6H3;2-3,11-14H,5-10H2,1H3;1-5H2;/q2*-1;;+2 |
| InChIKey | AXUJPDBAWRMNMC-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.15 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|