About CID 173138301
CID 173138301 (PubChem CID 173138301) has the molecular formula C44H50Zr
and a molecular weight of 670.11 g/mol.
Molecular Properties
| Compound Name | CID 173138301 |
| PubChem CID | 173138301 |
| Molecular Formula | C44H50Zr |
| Molecular Weight | 670.11 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | — |
| SMILES | CC1=CC(C)(C)c2cc3[cH-]c4cc5c(cc4c3cc21)C(C)=CC5(C)C.CCC1=[C-]C(C)C=C1C(C)(C)C.[Zr+2]=Cc1ccccc1 |
| InChI | InChI=1S/C25H25.C12H19.C7H6.Zr/c1-14-12-24(3,4)22-8-16-7-17-9-23-19(15(2)13-25(23,5)6)11-21(17)20(16)10-18(14)22;1-6-10-7-9(2)8-11(10)12(3,4)5;1-7-5-3-2-4-6-7;/h7-13H,1-6H3;8-9H,6H2,1-5H3;1-6H;/q2*-1;;+2 |
| InChIKey | TWMVBLWSJUQGCC-UHFFFAOYSA-N |
| XLogP | 12.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 670.11 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 173138301 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173138301?
The IUPAC name of CID 173138301 (CID 173138301) is not available.
What is the SMILES notation for CID 173138301?
The canonical SMILES for CID 173138301 is CC1=CC(C)(C)c2cc3[cH-]c4cc5c(cc4c3cc21)C(C)=CC5(C)C.CCC1=[C-]C(C)C=C1C(C)(C)C.[Zr+2]=Cc1ccccc1.
What is the InChIKey of CID 173138301?
The InChIKey is TWMVBLWSJUQGCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25.C12H19.C7H6.Zr/c1-14-12-24(3,4)22-8-16-7-17-9-23-19(15(2)13-25(23,5)6)11-21(17)20(16)10-18(14)22;1-6-10-7-9(2)8-11(10)12(3,4)5;1-7-5-3-2-4-6-7;/h7-13H,1-6H3;8-9H,6H2,1-5H3;1-6H;/q2*-1;;+2.
What are the key properties of CID 173138301?
CID 173138301 has a molecular weight of 670.11 g/mol, XLogP of 12.23, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173138301 is sourced from PubChem (CID 173138301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).