C17H25NO3 — CID 140540653
cis-tert-butyl (1R,3R)-2,2-dimethyl-3-[(E,3E)-2-methyl-3-prop-2-ynoxyiminoprop-1-enyl]cyclopropane-1-carboxylate (PubChem CID 140540653) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is cis-tert-butyl (1R,3R)-2,2-dimethyl-3-[(E,3E)-2-methyl-3-prop-2-ynoxyiminoprop-1-enyl]cyclopropane-1-carboxylate.
| Compound Name | cis-tert-butyl (1R,3R)-2,2-dimethyl-3-[(E,3E)-2-methyl-3-prop-2-ynoxyiminoprop-1-enyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 140540653 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | cis-tert-butyl (1R,3R)-2,2-dimethyl-3-[(E,3E)-2-methyl-3-prop-2-ynoxyiminoprop-1-enyl]cyclopropane-1-carboxylate |
| SMILES | C#CCO/N=C/C(C)=C/[C@@H]1[C@@H](C(=O)OC(C)(C)C)C1(C)C |
| InChI | InChI=1S/C17H25NO3/c1-8-9-20-18-11-12(2)10-13-14(17(13,6)7)15(19)21-16(3,4)5/h1,10-11,13-14H,9H2,2-7H3/b12-10+,18-11+/t13-,14+/m1/s1 |
| InChIKey | ZEMBARZJYHMEDV-SLQRRQPGSA-N |
| XLogP | 3.18 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|