C20H27N3O5 — CID 140540651
cis-(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl (1R,3R)-2,2-dimethyl-3-[(E,3E)-2-methyl-3-propan-2-yloxyiminoprop-1-enyl]cyclopropane-1-carboxylate (PubChem CID 140540651) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is cis-(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl (1R,3R)-2,2-dimethyl-3-[(E,3E)-2-methyl-3-propan-2-yloxyiminoprop-1-enyl]cyclopropane-1-carboxylate.
| Compound Name | cis-(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl (1R,3R)-2,2-dimethyl-3-[(E,3E)-2-methyl-3-propan-2-yloxyiminoprop-1-enyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 140540651 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | cis-(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl (1R,3R)-2,2-dimethyl-3-[(E,3E)-2-methyl-3-propan-2-yloxyiminoprop-1-enyl]cyclopropane-1-carboxylate |
| SMILES | C#CCN1CC(=O)N(COC(=O)[C@@H]2[C@@H](/C=C(C)/C=N/OC(C)C)C2(C)C)C1=O |
| InChI | InChI=1S/C20H27N3O5/c1-7-8-22-11-16(24)23(19(22)26)12-27-18(25)17-15(20(17,5)6)9-14(4)10-21-28-13(2)3/h1,9-10,13,15,17H,8,11-12H2,2-6H3/b14-9+,21-10+/t15-,17+/m1/s1 |
| InChIKey | YXVOKKCBRFQCCH-OWEAUIJMSA-N |
| XLogP | 2.01 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|