About (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethylbutanoate
(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethylbutanoate (PubChem CID 149119004) has the molecular formula C13H18N2O4
and a molecular weight of 266.30 g/mol. Its IUPAC name is (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethylbutanoate |
| PubChem CID | 149119004 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethylbutanoate |
| SMILES | C#CCN1CC(=O)N(COC(=O)C(C)(C)CC)C1=O |
| InChI | InChI=1S/C13H18N2O4/c1-5-7-14-8-10(16)15(12(14)18)9-19-11(17)13(3,4)6-2/h1H,6-9H2,2-4H3 |
| InChIKey | QZDMEBZRZBATLS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethylbutanoate?
The IUPAC name of (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethylbutanoate (CID 149119004) is (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethylbutanoate.
What is the SMILES notation for (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethylbutanoate?
The canonical SMILES for (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethylbutanoate is C#CCN1CC(=O)N(COC(=O)C(C)(C)CC)C1=O.
What is the InChIKey of (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethylbutanoate?
The InChIKey is QZDMEBZRZBATLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4/c1-5-7-14-8-10(16)15(12(14)18)9-19-11(17)13(3,4)6-2/h1H,6-9H2,2-4H3.
What are the key properties of (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethylbutanoate?
(2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethylbutanoate has a molecular weight of 266.30 g/mol, XLogP of 0.82, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxo-3-prop-2-ynylimidazolidin-1-yl)methyl 2,2-dimethylbutanoate is sourced from PubChem (CID 149119004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).