C43H82NO5+ — CID 140540706
3,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl-(2-hydroxyethyl)-dimethylazanium (PubChem CID 140540706) has the molecular formula C43H82NO5+ and a molecular weight of 693.13 g/mol. Its IUPAC name is 3,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl-(2-hydroxyethyl)-dimethylazanium.
| Compound Name | 3,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl-(2-hydroxyethyl)-dimethylazanium |
|---|---|
| PubChem CID | 140540706 |
| Molecular Formula | C43H82NO5+ |
| Molecular Weight | 693.13 g/mol |
| Exact Mass | 692.62 |
| IUPAC Name | 3,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl-(2-hydroxyethyl)-dimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(CC[N+](C)(C)CCO)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C43H82NO5/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-41(46)48-43(37-38-44(3,4)39-40-45)49-42(47)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,43,45H,5-18,23-40H2,1-4H3/q+1/b21-19-,22-20- |
| InChIKey | HDCMHVHHPLLSGZ-WRBBJXAJSA-N |
| XLogP | 11.93 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.13 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|