C50H99IN2O8+2 — CID 173237812
[4-[bis(2-hydroxyethyl)-methylazaniumyl]-2,3-di(octadec-9-enoyloxy)butyl]-bis(2-hydroxyethyl)-methylazanium;hydroiodide (PubChem CID 173237812) has the molecular formula C50H99IN2O8+2 and a molecular weight of 983.25 g/mol. Its IUPAC name is [4-[bis(2-hydroxyethyl)-methylazaniumyl]-2,3-di(octadec-9-enoyloxy)butyl]-bis(2-hydroxyethyl)-methylazanium;hydroiodide.
| Compound Name | [4-[bis(2-hydroxyethyl)-methylazaniumyl]-2,3-di(octadec-9-enoyloxy)butyl]-bis(2-hydroxyethyl)-methylazanium;hydroiodide |
|---|---|
| PubChem CID | 173237812 |
| Molecular Formula | C50H99IN2O8+2 |
| Molecular Weight | 983.25 g/mol |
| Exact Mass | 982.64 |
| IUPAC Name | [4-[bis(2-hydroxyethyl)-methylazaniumyl]-2,3-di(octadec-9-enoyloxy)butyl]-bis(2-hydroxyethyl)-methylazanium;hydroiodide |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC(C[N+](C)(CCO)CCO)C(C[N+](C)(CCO)CCO)OC(=O)CCCCCCCC=CCCCCCCCC.I |
| InChI | InChI=1S/C50H98N2O8.HI/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-49(57)59-47(45-51(3,37-41-53)38-42-54)48(46-52(4,39-43-55)40-44-56)60-50(58)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2;/h19-22,47-48,53-56H,5-18,23-46H2,1-4H3;1H/q+2; |
| InChIKey | PJAZWJRXXBHHGK-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.25 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|