C6H8F2O — CID 140541377
3,4-difluorocyclopentane-1-carbaldehyde (PubChem CID 140541377) has the molecular formula C6H8F2O and a molecular weight of 134.12 g/mol. Its IUPAC name is 3,4-difluorocyclopentane-1-carbaldehyde.
| Compound Name | 3,4-difluorocyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 140541377 |
| Molecular Formula | C6H8F2O |
| Molecular Weight | 134.12 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 3,4-difluorocyclopentane-1-carbaldehyde |
| SMILES | O=CC1CC(F)C(F)C1 |
| InChI | InChI=1S/C6H8F2O/c7-5-1-4(3-9)2-6(5)8/h3-6H,1-2H2 |
| InChIKey | TWOLPTZPQFAVOB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.12 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|