C7H10O — CID 124571824
(1S,5S)-bicyclo[3.1.0]hexane-3-carbaldehyde (PubChem CID 124571824) has the molecular formula C7H10O and a molecular weight of 110.16 g/mol. Its IUPAC name is (1S,5S)-bicyclo[3.1.0]hexane-3-carbaldehyde.
| Compound Name | (1S,5S)-bicyclo[3.1.0]hexane-3-carbaldehyde |
|---|---|
| PubChem CID | 124571824 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | (1S,5S)-bicyclo[3.1.0]hexane-3-carbaldehyde |
| SMILES | O=CC1C[C@@H]2C[C@H]2C1 |
| InChI | InChI=1S/C7H10O/c8-4-5-1-6-3-7(6)2-5/h4-7H,1-3H2/t6-,7-/m1/s1 |
| InChIKey | FJCKHVMOZVPJID-RNFRBKRXSA-N |
| XLogP | 1.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|