C21H26F2N4O2 — CID 140542479
2-[(2S)-1-(cyanomethylamino)-4,4-difluoro-1-oxo-5-phenylpentan-2-yl]-5-azaspiro[2.5]octane-5-carboxamide (PubChem CID 140542479) has the molecular formula C21H26F2N4O2 and a molecular weight of 404.46 g/mol. Its IUPAC name is 2-[(2S)-1-(cyanomethylamino)-4,4-difluoro-1-oxo-5-phenylpentan-2-yl]-5-azaspiro[2.5]octane-5-carboxamide.
| Compound Name | 2-[(2S)-1-(cyanomethylamino)-4,4-difluoro-1-oxo-5-phenylpentan-2-yl]-5-azaspiro[2.5]octane-5-carboxamide |
|---|---|
| PubChem CID | 140542479 |
| Molecular Formula | C21H26F2N4O2 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-[(2S)-1-(cyanomethylamino)-4,4-difluoro-1-oxo-5-phenylpentan-2-yl]-5-azaspiro[2.5]octane-5-carboxamide |
| SMILES | N#CCNC(=O)[C@@H](CC(F)(F)Cc1ccccc1)C1CC12CCCN(C(N)=O)C2 |
| InChI | InChI=1S/C21H26F2N4O2/c22-21(23,11-15-5-2-1-3-6-15)12-16(18(28)26-9-8-24)17-13-20(17)7-4-10-27(14-20)19(25)29/h1-3,5-6,16-17H,4,7,9-14H2,(H2,25,29)(H,26,28)/t16-,17?,20?/m0/s1 |
| InChIKey | TYQGHGBQYPLJNS-VXESANQCSA-N |
| XLogP | 2.69 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|