C13H13F2N3O2 — CID 87889620
(2S)-N-(cyanomethyl)-3,3-difluoro-2-phenylpentanediamide (PubChem CID 87889620) has the molecular formula C13H13F2N3O2 and a molecular weight of 281.26 g/mol. Its IUPAC name is (2S)-N-(cyanomethyl)-3,3-difluoro-2-phenylpentanediamide.
| Compound Name | (2S)-N-(cyanomethyl)-3,3-difluoro-2-phenylpentanediamide |
|---|---|
| PubChem CID | 87889620 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | (2S)-N-(cyanomethyl)-3,3-difluoro-2-phenylpentanediamide |
| SMILES | N#CCNC(=O)[C@H](c1ccccc1)C(F)(F)CC(N)=O |
| InChI | InChI=1S/C13H13F2N3O2/c14-13(15,8-10(17)19)11(12(20)18-7-6-16)9-4-2-1-3-5-9/h1-5,11H,7-8H2,(H2,17,19)(H,18,20)/t11-/m0/s1 |
| InChIKey | XLCSEHNGJWYQNF-NSHDSACASA-N |
| XLogP | 0.92 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|