C8H16FNOS — CID 140545342
(3S,4R)-4-(2-fluoroethylsulfanylmethyl)-1-methylpyrrolidin-3-ol (PubChem CID 140545342) has the molecular formula C8H16FNOS and a molecular weight of 193.29 g/mol. Its IUPAC name is (3S,4R)-4-(2-fluoroethylsulfanylmethyl)-1-methylpyrrolidin-3-ol.
| Compound Name | (3S,4R)-4-(2-fluoroethylsulfanylmethyl)-1-methylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 140545342 |
| Molecular Formula | C8H16FNOS |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | (3S,4R)-4-(2-fluoroethylsulfanylmethyl)-1-methylpyrrolidin-3-ol |
| SMILES | CN1C[C@@H](CSCCF)[C@H](O)C1 |
| InChI | InChI=1S/C8H16FNOS/c1-10-4-7(8(11)5-10)6-12-3-2-9/h7-8,11H,2-6H2,1H3/t7-,8+/m0/s1 |
| InChIKey | VQRUACWPDOMGRR-JGVFFNPUSA-N |
| XLogP | 0.61 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|