C8H17NOS — CID 11241304
(3R,4S)-4-(propan-2-ylsulfanylmethyl)pyrrolidin-3-ol (PubChem CID 11241304) has the molecular formula C8H17NOS and a molecular weight of 175.30 g/mol. Its IUPAC name is (3R,4S)-4-(propan-2-ylsulfanylmethyl)pyrrolidin-3-ol.
| Compound Name | (3R,4S)-4-(propan-2-ylsulfanylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 11241304 |
| Molecular Formula | C8H17NOS |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | (3R,4S)-4-(propan-2-ylsulfanylmethyl)pyrrolidin-3-ol |
| SMILES | CC(C)SC[C@H]1CNC[C@@H]1O |
| InChI | InChI=1S/C8H17NOS/c1-6(2)11-5-7-3-9-4-8(7)10/h6-10H,3-5H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | ZXNVGMZCHUVTQB-SFYZADRCSA-N |
| XLogP | 0.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |