About (E)-bis(3,4-dihydropyrazol-2-yl)diazene
(E)-bis(3,4-dihydropyrazol-2-yl)diazene (PubChem CID 140546011) has the molecular formula C6H10N6
and a molecular weight of 166.19 g/mol. Its IUPAC name is (E)-bis(3,4-dihydropyrazol-2-yl)diazene.
Molecular Properties
| Compound Name | (E)-bis(3,4-dihydropyrazol-2-yl)diazene |
| PubChem CID | 140546011 |
| Molecular Formula | C6H10N6 |
| Molecular Weight | 166.19 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (E)-bis(3,4-dihydropyrazol-2-yl)diazene |
| SMILES | C1=NN(/N=N/N2CCC=N2)CC1 |
| InChI | InChI=1S/C6H10N6/c1-3-7-11(5-1)9-10-12-6-2-4-8-12/h3-4H,1-2,5-6H2/b10-9+ |
| InChIKey | LHMSGVHXQJLRJY-MDZDMXLPSA-N |
| XLogP | 0.65 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-bis(3,4-dihydropyrazol-2-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-bis(3,4-dihydropyrazol-2-yl)diazene?
The IUPAC name of (E)-bis(3,4-dihydropyrazol-2-yl)diazene (CID 140546011) is (E)-bis(3,4-dihydropyrazol-2-yl)diazene.
What is the SMILES notation for (E)-bis(3,4-dihydropyrazol-2-yl)diazene?
The canonical SMILES for (E)-bis(3,4-dihydropyrazol-2-yl)diazene is C1=NN(/N=N/N2CCC=N2)CC1.
What is the InChIKey of (E)-bis(3,4-dihydropyrazol-2-yl)diazene?
The InChIKey is LHMSGVHXQJLRJY-MDZDMXLPSA-N. The full InChI is InChI=1S/C6H10N6/c1-3-7-11(5-1)9-10-12-6-2-4-8-12/h3-4H,1-2,5-6H2/b10-9+.
What are the key properties of (E)-bis(3,4-dihydropyrazol-2-yl)diazene?
(E)-bis(3,4-dihydropyrazol-2-yl)diazene has a molecular weight of 166.19 g/mol, XLogP of 0.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-bis(3,4-dihydropyrazol-2-yl)diazene is sourced from PubChem (CID 140546011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).