About 2-(3,4-dihydropyrazol-2-yl)-3,4-dihydropyrazole
2-(3,4-dihydropyrazol-2-yl)-3,4-dihydropyrazole (PubChem CID 20531290) has the molecular formula C6H10N4
and a molecular weight of 138.17 g/mol. Its IUPAC name is 2-(3,4-dihydropyrazol-2-yl)-3,4-dihydropyrazole.
Analyze 2-(3,4-dihydropyrazol-2-yl)-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydropyrazol-2-yl)-3,4-dihydropyrazole?
The IUPAC name of 2-(3,4-dihydropyrazol-2-yl)-3,4-dihydropyrazole (CID 20531290) is 2-(3,4-dihydropyrazol-2-yl)-3,4-dihydropyrazole.
What is the SMILES notation for 2-(3,4-dihydropyrazol-2-yl)-3,4-dihydropyrazole?
The canonical SMILES for 2-(3,4-dihydropyrazol-2-yl)-3,4-dihydropyrazole is C1=NN(N2CCC=N2)CC1.
What is the InChIKey of 2-(3,4-dihydropyrazol-2-yl)-3,4-dihydropyrazole?
The InChIKey is CNCXBJRVGYSPNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4/c1-3-7-9(5-1)10-6-2-4-8-10/h3-4H,1-2,5-6H2.
What are the key properties of 2-(3,4-dihydropyrazol-2-yl)-3,4-dihydropyrazole?
2-(3,4-dihydropyrazol-2-yl)-3,4-dihydropyrazole has a molecular weight of 138.17 g/mol, XLogP of 0.28, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydropyrazol-2-yl)-3,4-dihydropyrazole is sourced from PubChem (CID 20531290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).