C13H14N4O3 — CID 140548835
2-[2-(carbamoylamino)-4-methoxyphenyl]-1H-pyrrole-3-carboxamide (PubChem CID 140548835) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-[2-(carbamoylamino)-4-methoxyphenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 2-[2-(carbamoylamino)-4-methoxyphenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 140548835 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-[2-(carbamoylamino)-4-methoxyphenyl]-1H-pyrrole-3-carboxamide |
| SMILES | COc1ccc(-c2[nH]ccc2C(N)=O)c(NC(N)=O)c1 |
| InChI | InChI=1S/C13H14N4O3/c1-20-7-2-3-8(10(6-7)17-13(15)19)11-9(12(14)18)4-5-16-11/h2-6,16H,1H3,(H2,14,18)(H3,15,17,19) |
| InChIKey | OWMNZBWJLFWLNH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |