C21H17FO4 — CID 140551756
3-[[3-(carboxymethyl)-7-fluoro-2-methylnaphthalen-1-yl]methyl]benzoic acid (PubChem CID 140551756) has the molecular formula C21H17FO4 and a molecular weight of 352.36 g/mol. Its IUPAC name is 3-[[3-(carboxymethyl)-7-fluoro-2-methylnaphthalen-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[3-(carboxymethyl)-7-fluoro-2-methylnaphthalen-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 140551756 |
| Molecular Formula | C21H17FO4 |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 3-[[3-(carboxymethyl)-7-fluoro-2-methylnaphthalen-1-yl]methyl]benzoic acid |
| SMILES | Cc1c(CC(=O)O)cc2ccc(F)cc2c1Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C21H17FO4/c1-12-16(10-20(23)24)9-14-5-6-17(22)11-19(14)18(12)8-13-3-2-4-15(7-13)21(25)26/h2-7,9,11H,8,10H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | GVDMULGHYXBTFE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |