C17H32N2O3S — CID 140556941
N-[(4S)-2-oxoazepan-4-yl]-4-pentylcyclohexane-1-sulfonamide (PubChem CID 140556941) has the molecular formula C17H32N2O3S and a molecular weight of 344.52 g/mol. Its IUPAC name is N-[(4S)-2-oxoazepan-4-yl]-4-pentylcyclohexane-1-sulfonamide.
| Compound Name | N-[(4S)-2-oxoazepan-4-yl]-4-pentylcyclohexane-1-sulfonamide |
|---|---|
| PubChem CID | 140556941 |
| Molecular Formula | C17H32N2O3S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | N-[(4S)-2-oxoazepan-4-yl]-4-pentylcyclohexane-1-sulfonamide |
| SMILES | CCCCCC1CCC(S(=O)(=O)N[C@H]2CCCNC(=O)C2)CC1 |
| InChI | InChI=1S/C17H32N2O3S/c1-2-3-4-6-14-8-10-16(11-9-14)23(21,22)19-15-7-5-12-18-17(20)13-15/h14-16,19H,2-13H2,1H3,(H,18,20)/t14?,15-,16?/m0/s1 |
| InChIKey | YJDRDYCZXHKPPA-PCKAHOCUSA-N |
| XLogP | 2.71 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|