C18H34N2O3 — CID 66909938
(3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide (PubChem CID 66909938) has the molecular formula C18H34N2O3 and a molecular weight of 326.48 g/mol. Its IUPAC name is (3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide.
| Compound Name | (3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide |
|---|---|
| PubChem CID | 66909938 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | (3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide |
| SMILES | CCCCCCC[C@H](O)C(C)(C)C(=O)N[C@H]1CCCNC(=O)C1 |
| InChI | InChI=1S/C18H34N2O3/c1-4-5-6-7-8-11-15(21)18(2,3)17(23)20-14-10-9-12-19-16(22)13-14/h14-15,21H,4-13H2,1-3H3,(H,19,22)(H,20,23)/t14-,15-/m0/s1 |
| InChIKey | CECGNPGDUDZAHT-GJZGRUSLSA-N |
| XLogP | 2.52 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|