About (3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide
(3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide (PubChem CID 66909938) has the molecular formula C18H34N2O3
and a molecular weight of 326.48 g/mol. Its IUPAC name is (3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide.
Molecular Properties
| Compound Name | (3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide |
| PubChem CID | 66909938 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | (3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide |
| SMILES | CCCCCCC[C@H](O)C(C)(C)C(=O)N[C@H]1CCCNC(=O)C1 |
| InChI | InChI=1S/C18H34N2O3/c1-4-5-6-7-8-11-15(21)18(2,3)17(23)20-14-10-9-12-19-16(22)13-14/h14-15,21H,4-13H2,1-3H3,(H,19,22)(H,20,23)/t14-,15-/m0/s1 |
| InChIKey | CECGNPGDUDZAHT-GJZGRUSLSA-N |
| XLogP | 2.52 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide?
The IUPAC name of (3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide (CID 66909938) is (3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide.
What is the SMILES notation for (3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide?
The canonical SMILES for (3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide is CCCCCCC[C@H](O)C(C)(C)C(=O)N[C@H]1CCCNC(=O)C1.
What is the InChIKey of (3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide?
The InChIKey is CECGNPGDUDZAHT-GJZGRUSLSA-N. The full InChI is InChI=1S/C18H34N2O3/c1-4-5-6-7-8-11-15(21)18(2,3)17(23)20-14-10-9-12-19-16(22)13-14/h14-15,21H,4-13H2,1-3H3,(H,19,22)(H,20,23)/t14-,15-/m0/s1.
What are the key properties of (3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide?
(3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide has a molecular weight of 326.48 g/mol, XLogP of 2.52, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-hydroxy-2,2-dimethyl-N-[(4S)-2-oxoazepan-4-yl]decanamide is sourced from PubChem (CID 66909938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).