C17H31NO3 — CID 91602626
(4S)-4-[(2R,3S)-3-hydroxy-2-methyldecanoyl]azepan-2-one (PubChem CID 91602626) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is (4S)-4-[(2R,3S)-3-hydroxy-2-methyldecanoyl]azepan-2-one.
| Compound Name | (4S)-4-[(2R,3S)-3-hydroxy-2-methyldecanoyl]azepan-2-one |
|---|---|
| PubChem CID | 91602626 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | (4S)-4-[(2R,3S)-3-hydroxy-2-methyldecanoyl]azepan-2-one |
| SMILES | CCCCCCC[C@H](O)[C@@H](C)C(=O)[C@H]1CCCNC(=O)C1 |
| InChI | InChI=1S/C17H31NO3/c1-3-4-5-6-7-10-15(19)13(2)17(21)14-9-8-11-18-16(20)12-14/h13-15,19H,3-12H2,1-2H3,(H,18,20)/t13-,14+,15+/m1/s1 |
| InChIKey | KGSFZTPGUVHGCC-ILXRZTDVSA-N |
| XLogP | 2.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|