C8H11N3O4 — CID 140557770
3-[(5-oxo-1,2-dihydropyrazole-3-carbonyl)amino]butanoic acid (PubChem CID 140557770) has the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. Its IUPAC name is 3-[(5-oxo-1,2-dihydropyrazole-3-carbonyl)amino]butanoic acid.
| Compound Name | 3-[(5-oxo-1,2-dihydropyrazole-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 140557770 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 3-[(5-oxo-1,2-dihydropyrazole-3-carbonyl)amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)c1cc(=O)[nH][nH]1 |
| InChI | InChI=1S/C8H11N3O4/c1-4(2-7(13)14)9-8(15)5-3-6(12)11-10-5/h3-4H,2H2,1H3,(H,9,15)(H,13,14)(H2,10,11,12) |
| InChIKey | PRRWYBCNLIXRSI-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |