C9H13N3O4 — CID 166392919
2-[(2-methyl-3-oxo-1H-pyrazole-5-carbonyl)amino]butanoic acid (PubChem CID 166392919) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-[(2-methyl-3-oxo-1H-pyrazole-5-carbonyl)amino]butanoic acid.
| Compound Name | 2-[(2-methyl-3-oxo-1H-pyrazole-5-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 166392919 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-[(2-methyl-3-oxo-1H-pyrazole-5-carbonyl)amino]butanoic acid |
| SMILES | CCC(NC(=O)c1cc(=O)n(C)[nH]1)C(=O)O |
| InChI | InChI=1S/C9H13N3O4/c1-3-5(9(15)16)10-8(14)6-4-7(13)12(2)11-6/h4-5,11H,3H2,1-2H3,(H,10,14)(H,15,16) |
| InChIKey | OXTCIGDHOXRHEI-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |