C15H16N2O3S2 — CID 140560336
methyl (E)-3-[5-[2-(2-acetamido-3H-1,3-thiazol-2-yl)ethenyl]thiophen-3-yl]prop-2-enoate (PubChem CID 140560336) has the molecular formula C15H16N2O3S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is methyl (E)-3-[5-[2-(2-acetamido-3H-1,3-thiazol-2-yl)ethenyl]thiophen-3-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[5-[2-(2-acetamido-3H-1,3-thiazol-2-yl)ethenyl]thiophen-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 140560336 |
| Molecular Formula | C15H16N2O3S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | methyl (E)-3-[5-[2-(2-acetamido-3H-1,3-thiazol-2-yl)ethenyl]thiophen-3-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1csc(C=CC2(NC(C)=O)NC=CS2)c1 |
| InChI | InChI=1S/C15H16N2O3S2/c1-11(18)17-15(16-7-8-22-15)6-5-13-9-12(10-21-13)3-4-14(19)20-2/h3-10,16H,1-2H3,(H,17,18)/b4-3+,6-5? |
| InChIKey | PNXAJRABQHZGMD-WAVJCGAHSA-N |
| XLogP | 2.55 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|