C7H8ClN3O — CID 14056219
2-chloro-6-methylpyridine-3-carbohydrazide (PubChem CID 14056219) has the molecular formula C7H8ClN3O and a molecular weight of 185.61 g/mol. Its IUPAC name is 2-chloro-6-methylpyridine-3-carbohydrazide.
| Compound Name | 2-chloro-6-methylpyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 14056219 |
| Molecular Formula | C7H8ClN3O |
| Molecular Weight | 185.61 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | 2-chloro-6-methylpyridine-3-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NN)c(Cl)n1 |
| InChI | InChI=1S/C7H8ClN3O/c1-4-2-3-5(6(8)10-4)7(12)11-9/h2-3H,9H2,1H3,(H,11,12) |
| InChIKey | ZVJWNCJTRVTLKT-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.61 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|