C24H31Cl2N5O — CID 140563127
N-[2-[[(3R)-1-[(2-aminophenyl)methyl]piperidin-3-yl]methyl]-3,4-dichlorophenyl]piperazine-1-carboxamide (PubChem CID 140563127) has the molecular formula C24H31Cl2N5O and a molecular weight of 476.45 g/mol. Its IUPAC name is N-[2-[[(3R)-1-[(2-aminophenyl)methyl]piperidin-3-yl]methyl]-3,4-dichlorophenyl]piperazine-1-carboxamide.
| Compound Name | N-[2-[[(3R)-1-[(2-aminophenyl)methyl]piperidin-3-yl]methyl]-3,4-dichlorophenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 140563127 |
| Molecular Formula | C24H31Cl2N5O |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | N-[2-[[(3R)-1-[(2-aminophenyl)methyl]piperidin-3-yl]methyl]-3,4-dichlorophenyl]piperazine-1-carboxamide |
| SMILES | Nc1ccccc1CN1CCC[C@H](Cc2c(NC(=O)N3CCNCC3)ccc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C24H31Cl2N5O/c25-20-7-8-22(29-24(32)31-12-9-28-10-13-31)19(23(20)26)14-17-4-3-11-30(15-17)16-18-5-1-2-6-21(18)27/h1-2,5-8,17,28H,3-4,9-16,27H2,(H,29,32)/t17-/m1/s1 |
| InChIKey | FDWOYZNWZKRAMO-QGZVFWFLSA-N |
| XLogP | 4.47 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|