C18H20IN3O2S — CID 140563617
ethyl 6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]-8-iodoindolizine-2-carboxylate (PubChem CID 140563617) has the molecular formula C18H20IN3O2S and a molecular weight of 469.35 g/mol. Its IUPAC name is ethyl 6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]-8-iodoindolizine-2-carboxylate.
| Compound Name | ethyl 6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]-8-iodoindolizine-2-carboxylate |
|---|---|
| PubChem CID | 140563617 |
| Molecular Formula | C18H20IN3O2S |
| Molecular Weight | 469.35 g/mol |
| Exact Mass | 469.03 |
| IUPAC Name | ethyl 6-[2-[[(2R)-butan-2-yl]amino]-1,3-thiazol-5-yl]-8-iodoindolizine-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(I)cc(-c3cnc(N[C@H](C)CC)s3)cn2c1 |
| InChI | InChI=1S/C18H20IN3O2S/c1-4-11(3)21-18-20-8-16(25-18)12-6-14(19)15-7-13(10-22(15)9-12)17(23)24-5-2/h6-11H,4-5H2,1-3H3,(H,20,21)/t11-/m1/s1 |
| InChIKey | YEZARZGVOZBBDN-LLVKDONJSA-N |
| XLogP | 5.05 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|