About 3-[(2-methoxy-4,6-diphenylphenyl)methoxy]propan-1-amine
3-[(2-methoxy-4,6-diphenylphenyl)methoxy]propan-1-amine (PubChem CID 140569407) has the molecular formula C23H25NO2
and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-[(2-methoxy-4,6-diphenylphenyl)methoxy]propan-1-amine.
Molecular Properties
| Compound Name | 3-[(2-methoxy-4,6-diphenylphenyl)methoxy]propan-1-amine |
| PubChem CID | 140569407 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 3-[(2-methoxy-4,6-diphenylphenyl)methoxy]propan-1-amine |
| SMILES | COc1cc(-c2ccccc2)cc(-c2ccccc2)c1COCCCN |
| InChI | InChI=1S/C23H25NO2/c1-25-23-16-20(18-9-4-2-5-10-18)15-21(19-11-6-3-7-12-19)22(23)17-26-14-8-13-24/h2-7,9-12,15-16H,8,13-14,17,24H2,1H3 |
| InChIKey | FZNAJGYUUZNKHW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-methoxy-4,6-diphenylphenyl)methoxy]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-methoxy-4,6-diphenylphenyl)methoxy]propan-1-amine?
The IUPAC name of 3-[(2-methoxy-4,6-diphenylphenyl)methoxy]propan-1-amine (CID 140569407) is 3-[(2-methoxy-4,6-diphenylphenyl)methoxy]propan-1-amine.
What is the SMILES notation for 3-[(2-methoxy-4,6-diphenylphenyl)methoxy]propan-1-amine?
The canonical SMILES for 3-[(2-methoxy-4,6-diphenylphenyl)methoxy]propan-1-amine is COc1cc(-c2ccccc2)cc(-c2ccccc2)c1COCCCN.
What is the InChIKey of 3-[(2-methoxy-4,6-diphenylphenyl)methoxy]propan-1-amine?
The InChIKey is FZNAJGYUUZNKHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO2/c1-25-23-16-20(18-9-4-2-5-10-18)15-21(19-11-6-3-7-12-19)22(23)17-26-14-8-13-24/h2-7,9-12,15-16H,8,13-14,17,24H2,1H3.
What are the key properties of 3-[(2-methoxy-4,6-diphenylphenyl)methoxy]propan-1-amine?
3-[(2-methoxy-4,6-diphenylphenyl)methoxy]propan-1-amine has a molecular weight of 347.46 g/mol, XLogP of 4.89, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-methoxy-4,6-diphenylphenyl)methoxy]propan-1-amine is sourced from PubChem (CID 140569407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).