C21H18ClFN4S — CID 140570159
4-[(2S)-2-amino-3-(4-chlorophenyl)propyl]-5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-amine (PubChem CID 140570159) has the molecular formula C21H18ClFN4S and a molecular weight of 412.92 g/mol. Its IUPAC name is 4-[(2S)-2-amino-3-(4-chlorophenyl)propyl]-5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-[(2S)-2-amino-3-(4-chlorophenyl)propyl]-5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 140570159 |
| Molecular Formula | C21H18ClFN4S |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 4-[(2S)-2-amino-3-(4-chlorophenyl)propyl]-5-(3-fluoroisoquinolin-6-yl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(C[C@@H](N)Cc2ccc(Cl)cc2)c(-c2ccc3cnc(F)cc3c2)s1 |
| InChI | InChI=1S/C21H18ClFN4S/c22-16-5-1-12(2-6-16)7-17(24)10-18-20(28-21(25)27-18)13-3-4-14-11-26-19(23)9-15(14)8-13/h1-6,8-9,11,17H,7,10,24H2,(H2,25,27)/t17-/m0/s1 |
| InChIKey | RCUMDYBHIOOBOJ-KRWDZBQOSA-N |
| XLogP | 4.85 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|