C21H20N2O3S — CID 140571976
N-[[2-(3-methylphenyl)-5-methylsulfonylphenyl]methyl]pyridine-3-carboxamide (PubChem CID 140571976) has the molecular formula C21H20N2O3S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[[2-(3-methylphenyl)-5-methylsulfonylphenyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[2-(3-methylphenyl)-5-methylsulfonylphenyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 140571976 |
| Molecular Formula | C21H20N2O3S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[[2-(3-methylphenyl)-5-methylsulfonylphenyl]methyl]pyridine-3-carboxamide |
| SMILES | Cc1cccc(-c2ccc(S(C)(=O)=O)cc2CNC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C21H20N2O3S/c1-15-5-3-6-16(11-15)20-9-8-19(27(2,25)26)12-18(20)14-23-21(24)17-7-4-10-22-13-17/h3-13H,14H2,1-2H3,(H,23,24) |
| InChIKey | SRPLXIBLQBOGGR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |