C29H24N2O3S — CID 10227671
N-[(4-methylsulfonylphenyl)methyl]-3-[3-(3-pyridin-3-ylphenyl)prop-1-ynyl]benzamide (PubChem CID 10227671) has the molecular formula C29H24N2O3S and a molecular weight of 480.59 g/mol. Its IUPAC name is N-[(4-methylsulfonylphenyl)methyl]-3-[3-(3-pyridin-3-ylphenyl)prop-1-ynyl]benzamide.
| Compound Name | N-[(4-methylsulfonylphenyl)methyl]-3-[3-(3-pyridin-3-ylphenyl)prop-1-ynyl]benzamide |
|---|---|
| PubChem CID | 10227671 |
| Molecular Formula | C29H24N2O3S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | N-[(4-methylsulfonylphenyl)methyl]-3-[3-(3-pyridin-3-ylphenyl)prop-1-ynyl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(CNC(=O)c2cccc(C#CCc3cccc(-c4cccnc4)c3)c2)cc1 |
| InChI | InChI=1S/C29H24N2O3S/c1-35(33,34)28-15-13-24(14-16-28)20-31-29(32)26-11-4-9-23(19-26)7-2-6-22-8-3-10-25(18-22)27-12-5-17-30-21-27/h3-5,8-19,21H,6,20H2,1H3,(H,31,32) |
| InChIKey | RHZYZGQEBITRJB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|