C24H21NO — CID 142234863
N-[(4-methylphenyl)methyl]-3-(3-phenylprop-1-ynyl)benzamide (PubChem CID 142234863) has the molecular formula C24H21NO and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-3-(3-phenylprop-1-ynyl)benzamide.
| Compound Name | N-[(4-methylphenyl)methyl]-3-(3-phenylprop-1-ynyl)benzamide |
|---|---|
| PubChem CID | 142234863 |
| Molecular Formula | C24H21NO |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-3-(3-phenylprop-1-ynyl)benzamide |
| SMILES | Cc1ccc(CNC(=O)c2cccc(C#CCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H21NO/c1-19-13-15-22(16-14-19)18-25-24(26)23-12-6-11-21(17-23)10-5-9-20-7-3-2-4-8-20/h2-4,6-8,11-17H,9,18H2,1H3,(H,25,26) |
| InChIKey | QLHYRXPJWVXQLB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|