C19H27FN2O4 — CID 140572023
[3-[[5-fluoro-3-(oxan-4-yl)-2-pyridinyl]oxy]cyclobutyl] N-tert-butylcarbamate (PubChem CID 140572023) has the molecular formula C19H27FN2O4 and a molecular weight of 366.43 g/mol. Its IUPAC name is [3-[[5-fluoro-3-(oxan-4-yl)-2-pyridinyl]oxy]cyclobutyl] N-tert-butylcarbamate.
| Compound Name | [3-[[5-fluoro-3-(oxan-4-yl)-2-pyridinyl]oxy]cyclobutyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 140572023 |
| Molecular Formula | C19H27FN2O4 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | [3-[[5-fluoro-3-(oxan-4-yl)-2-pyridinyl]oxy]cyclobutyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CC(Oc2ncc(F)cc2C2CCOCC2)C1 |
| InChI | InChI=1S/C19H27FN2O4/c1-19(2,3)22-18(23)26-15-9-14(10-15)25-17-16(8-13(20)11-21-17)12-4-6-24-7-5-12/h8,11-12,14-15H,4-7,9-10H2,1-3H3,(H,22,23) |
| InChIKey | OPFFZMAXLZXJMM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |