C19H24F3NO4 — CID 165144307
[3-[3-[2-(trifluoromethyl)oxetan-2-yl]phenoxy]cyclobutyl] N-tert-butylcarbamate (PubChem CID 165144307) has the molecular formula C19H24F3NO4 and a molecular weight of 387.40 g/mol. Its IUPAC name is [3-[3-[2-(trifluoromethyl)oxetan-2-yl]phenoxy]cyclobutyl] N-tert-butylcarbamate.
| Compound Name | [3-[3-[2-(trifluoromethyl)oxetan-2-yl]phenoxy]cyclobutyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 165144307 |
| Molecular Formula | C19H24F3NO4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | [3-[3-[2-(trifluoromethyl)oxetan-2-yl]phenoxy]cyclobutyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CC(Oc2cccc(C3(C(F)(F)F)CCO3)c2)C1 |
| InChI | InChI=1S/C19H24F3NO4/c1-17(2,3)23-16(24)27-15-10-14(11-15)26-13-6-4-5-12(9-13)18(7-8-25-18)19(20,21)22/h4-6,9,14-15H,7-8,10-11H2,1-3H3,(H,23,24) |
| InChIKey | LVZBNSFRDFQTLR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |