C27H33NO5 — CID 174186478
4-[1-[[4-(3-cyclohexyloxyphenyl)oxane-4-carbonyl]amino]ethyl]benzoic acid (PubChem CID 174186478) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is 4-[1-[[4-(3-cyclohexyloxyphenyl)oxane-4-carbonyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[1-[[4-(3-cyclohexyloxyphenyl)oxane-4-carbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 174186478 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 4-[1-[[4-(3-cyclohexyloxyphenyl)oxane-4-carbonyl]amino]ethyl]benzoic acid |
| SMILES | CC(NC(=O)C1(c2cccc(OC3CCCCC3)c2)CCOCC1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C27H33NO5/c1-19(20-10-12-21(13-11-20)25(29)30)28-26(31)27(14-16-32-17-15-27)22-6-5-9-24(18-22)33-23-7-3-2-4-8-23/h5-6,9-13,18-19,23H,2-4,7-8,14-17H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | OAQACOKKTCGDKV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |