C25H31NO3 — CID 86941870
N-[(3-cyclohexyloxyphenyl)methyl]-4-phenyloxane-4-carboxamide (PubChem CID 86941870) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is N-[(3-cyclohexyloxyphenyl)methyl]-4-phenyloxane-4-carboxamide.
| Compound Name | N-[(3-cyclohexyloxyphenyl)methyl]-4-phenyloxane-4-carboxamide |
|---|---|
| PubChem CID | 86941870 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | N-[(3-cyclohexyloxyphenyl)methyl]-4-phenyloxane-4-carboxamide |
| SMILES | O=C(NCc1cccc(OC2CCCCC2)c1)C1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C25H31NO3/c27-24(25(14-16-28-17-15-25)21-9-3-1-4-10-21)26-19-20-8-7-13-23(18-20)29-22-11-5-2-6-12-22/h1,3-4,7-10,13,18,22H,2,5-6,11-12,14-17,19H2,(H,26,27) |
| InChIKey | SGLQKYONXBCMPY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |