C22H24N2O3 — CID 166213239
1-(1-benzofuran-6-ylmethyl)-3-[(3-cyclopentyloxyphenyl)methyl]urea (PubChem CID 166213239) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-(1-benzofuran-6-ylmethyl)-3-[(3-cyclopentyloxyphenyl)methyl]urea.
| Compound Name | 1-(1-benzofuran-6-ylmethyl)-3-[(3-cyclopentyloxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 166213239 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1-(1-benzofuran-6-ylmethyl)-3-[(3-cyclopentyloxyphenyl)methyl]urea |
| SMILES | O=C(NCc1cccc(OC2CCCC2)c1)NCc1ccc2ccoc2c1 |
| InChI | InChI=1S/C22H24N2O3/c25-22(24-15-17-8-9-18-10-11-26-21(18)13-17)23-14-16-4-3-7-20(12-16)27-19-5-1-2-6-19/h3-4,7-13,19H,1-2,5-6,14-15H2,(H2,23,24,25) |
| InChIKey | WSLJYWJNEDVKIL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |