C19H37F3N6O2 — CID 140573587
6-ethoxy-4-N-(3-morpholin-4-ylpropyl)-2-N-[3-(trifluoromethyl)cyclohexyl]-1,3,5-triazinane-2,4-diamine (PubChem CID 140573587) has the molecular formula C19H37F3N6O2 and a molecular weight of 438.54 g/mol. Its IUPAC name is 6-ethoxy-4-N-(3-morpholin-4-ylpropyl)-2-N-[3-(trifluoromethyl)cyclohexyl]-1,3,5-triazinane-2,4-diamine.
| Compound Name | 6-ethoxy-4-N-(3-morpholin-4-ylpropyl)-2-N-[3-(trifluoromethyl)cyclohexyl]-1,3,5-triazinane-2,4-diamine |
|---|---|
| PubChem CID | 140573587 |
| Molecular Formula | C19H37F3N6O2 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 6-ethoxy-4-N-(3-morpholin-4-ylpropyl)-2-N-[3-(trifluoromethyl)cyclohexyl]-1,3,5-triazinane-2,4-diamine |
| SMILES | CCOC1NC(NCCCN2CCOCC2)NC(NC2CCCC(C(F)(F)F)C2)N1 |
| InChI | InChI=1S/C19H37F3N6O2/c1-2-30-18-26-16(23-7-4-8-28-9-11-29-12-10-28)25-17(27-18)24-15-6-3-5-14(13-15)19(20,21)22/h14-18,23-27H,2-13H2,1H3 |
| InChIKey | NZHRZRBAKHQLPX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 81.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|