C23H43F3N6O4S — CID 140573615
CID 140573615 (PubChem CID 140573615) has the molecular formula C23H43F3N6O4S and a molecular weight of 556.70 g/mol.
| Compound Name | CID 140573615 |
|---|---|
| PubChem CID | 140573615 |
| Molecular Formula | C23H43F3N6O4S |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | — |
| SMILES | C[S+](=O)([O-])C1CCC(NC2NC(NC3CCCC(CN4CCOCC4)C3)NC(OCC(F)(F)F)N2)CC1 |
| InChI | InChI=1S/C23H43F3N6O4S/c1-37(33,34)19-7-5-17(6-8-19)27-20-29-21(31-22(30-20)36-15-23(24,25)26)28-18-4-2-3-16(13-18)14-32-9-11-35-12-10-32/h16-22,27-31H,2-15H2,1H3 |
| InChIKey | GUQATFMGKBBHFG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|