C17H36N2O — CID 176921987
4-(2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-ylmethyl)morpholine;ethane (PubChem CID 176921987) has the molecular formula C17H36N2O and a molecular weight of 284.49 g/mol. Its IUPAC name is 4-(2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-ylmethyl)morpholine;ethane.
| Compound Name | 4-(2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-ylmethyl)morpholine;ethane |
|---|---|
| PubChem CID | 176921987 |
| Molecular Formula | C17H36N2O |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.28 |
| IUPAC Name | 4-(2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-ylmethyl)morpholine;ethane |
| SMILES | C1CN(CC2CCC3CNCC3C2)CCO1.CC.CC |
| InChI | InChI=1S/C13H24N2O.2C2H6/c1-2-12-8-14-9-13(12)7-11(1)10-15-3-5-16-6-4-15;2*1-2/h11-14H,1-10H2;2*1-2H3 |
| InChIKey | ZMIIZSFXBJLDAO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |