C13H23N — CID 130900561
5-(2-cyclopropylethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole (PubChem CID 130900561) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 5-(2-cyclopropylethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole.
| Compound Name | 5-(2-cyclopropylethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole |
|---|---|
| PubChem CID | 130900561 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 5-(2-cyclopropylethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole |
| SMILES | C1CC1CCC1CCC2CNCC2C1 |
| InChI | InChI=1S/C13H23N/c1-2-10(1)3-4-11-5-6-12-8-14-9-13(12)7-11/h10-14H,1-9H2 |
| InChIKey | HTTYOHYZHBVVCD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |