C8H15NS — CID 141422755
2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole-5-thiol (PubChem CID 141422755) has the molecular formula C8H15NS and a molecular weight of 157.28 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole-5-thiol.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole-5-thiol |
|---|---|
| PubChem CID | 141422755 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole-5-thiol |
| SMILES | SC1CCC2CNCC2C1 |
| InChI | InChI=1S/C8H15NS/c10-8-2-1-6-4-9-5-7(6)3-8/h6-10H,1-5H2 |
| InChIKey | RPDWYVKBBJODDH-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|