C8H14FN — CID 105428512
5-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole (PubChem CID 105428512) has the molecular formula C8H14FN and a molecular weight of 143.21 g/mol. Its IUPAC name is 5-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole.
| Compound Name | 5-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole |
|---|---|
| PubChem CID | 105428512 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 5-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole |
| SMILES | FC1CCC2CNCC2C1 |
| InChI | InChI=1S/C8H14FN/c9-8-2-1-6-4-10-5-7(6)3-8/h6-8,10H,1-5H2 |
| InChIKey | UVWWAAVMFIUJLX-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |