C8H14BrN — CID 130804480
5-bromo-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole (PubChem CID 130804480) has the molecular formula C8H14BrN and a molecular weight of 204.11 g/mol. Its IUPAC name is 5-bromo-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole.
| Compound Name | 5-bromo-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole |
|---|---|
| PubChem CID | 130804480 |
| Molecular Formula | C8H14BrN |
| Molecular Weight | 204.11 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | 5-bromo-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole |
| SMILES | BrC1CCC2CNCC2C1 |
| InChI | InChI=1S/C8H14BrN/c9-8-2-1-6-4-10-5-7(6)3-8/h6-8,10H,1-5H2 |
| InChIKey | VOWLGDBKYRSJQS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.11 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|