C10H18BrN — CID 130256402
6-bromo-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine (PubChem CID 130256402) has the molecular formula C10H18BrN and a molecular weight of 232.16 g/mol. Its IUPAC name is 6-bromo-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine.
| Compound Name | 6-bromo-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 130256402 |
| Molecular Formula | C10H18BrN |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 6-bromo-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-amine |
| SMILES | NC1CCC2CC(Br)CCC2C1 |
| InChI | InChI=1S/C10H18BrN/c11-9-3-1-8-6-10(12)4-2-7(8)5-9/h7-10H,1-6,12H2 |
| InChIKey | HTIRIIXZQXGDME-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|